About 1-cyclopentylazepane
1-cyclopentylazepane (PubChem CID 23151197) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 1-cyclopentylazepane.
Molecular Properties
| Compound Name | 1-cyclopentylazepane |
| PubChem CID | 23151197 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1-cyclopentylazepane |
| SMILES | C1CCCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C11H21N/c1-2-6-10-12(9-5-1)11-7-3-4-8-11/h11H,1-10H2 |
| InChIKey | QSUANCLKGCNCMM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylazepane?
The IUPAC name of 1-cyclopentylazepane (CID 23151197) is 1-cyclopentylazepane.
What is the SMILES notation for 1-cyclopentylazepane?
The canonical SMILES for 1-cyclopentylazepane is C1CCCN(C2CCCC2)CC1.
What is the InChIKey of 1-cyclopentylazepane?
The InChIKey is QSUANCLKGCNCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-2-6-10-12(9-5-1)11-7-3-4-8-11/h11H,1-10H2.
What are the key properties of 1-cyclopentylazepane?
1-cyclopentylazepane has a molecular weight of 167.30 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylazepane is sourced from PubChem (CID 23151197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).