C24H25F4N3O2 — CID 23151358
3-[4-[3-(3-fluoropiperidin-1-yl)propoxy]phenyl]-2-methyl-5-(trifluoromethyl)quinazolin-4-one (PubChem CID 23151358) has the molecular formula C24H25F4N3O2 and a molecular weight of 463.48 g/mol. Its IUPAC name is 3-[4-[3-(3-fluoropiperidin-1-yl)propoxy]phenyl]-2-methyl-5-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-[4-[3-(3-fluoropiperidin-1-yl)propoxy]phenyl]-2-methyl-5-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23151358 |
| Molecular Formula | C24H25F4N3O2 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-[4-[3-(3-fluoropiperidin-1-yl)propoxy]phenyl]-2-methyl-5-(trifluoromethyl)quinazolin-4-one |
| SMILES | Cc1nc2cccc(C(F)(F)F)c2c(=O)n1-c1ccc(OCCCN2CCCC(F)C2)cc1 |
| InChI | InChI=1S/C24H25F4N3O2/c1-16-29-21-7-2-6-20(24(26,27)28)22(21)23(32)31(16)18-8-10-19(11-9-18)33-14-4-13-30-12-3-5-17(25)15-30/h2,6-11,17H,3-5,12-15H2,1H3 |
| InChIKey | OCGMYNRUSDFNBP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|