C23H19ClN4O — CID 23151473
5-chloro-7-methyl-6-phenyl-2-(2-phenylmethoxyethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 23151473) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is 5-chloro-7-methyl-6-phenyl-2-(2-phenylmethoxyethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | 5-chloro-7-methyl-6-phenyl-2-(2-phenylmethoxyethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 23151473 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-chloro-7-methyl-6-phenyl-2-(2-phenylmethoxyethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | Cc1c(-c2ccccc2)c(Cl)n2nc(CCOCc3ccccc3)nc2c1C#N |
| InChI | InChI=1S/C23H19ClN4O/c1-16-19(14-25)23-26-20(12-13-29-15-17-8-4-2-5-9-17)27-28(23)22(24)21(16)18-10-6-3-7-11-18/h2-11H,12-13,15H2,1H3 |
| InChIKey | KJKHAEZQWSDHAF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|