C17H16ClN5 — CID 23151509
6-butyl-5-chloro-7-methyl-2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 23151509) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is 6-butyl-5-chloro-7-methyl-2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | 6-butyl-5-chloro-7-methyl-2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 23151509 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-butyl-5-chloro-7-methyl-2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | CCCCc1c(C)c(C#N)c2nc(-c3ccccn3)nn2c1Cl |
| InChI | InChI=1S/C17H16ClN5/c1-3-4-7-12-11(2)13(10-19)17-21-16(22-23(17)15(12)18)14-8-5-6-9-20-14/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | NJODKHXEMIRTMK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|