About 5-fluoro-2-methylspiro[fluorene-9,4'-oxane]
5-fluoro-2-methylspiro[fluorene-9,4'-oxane] (PubChem CID 23151773) has the molecular formula C18H17FO
and a molecular weight of 268.33 g/mol. Its IUPAC name is 5-fluoro-2-methylspiro[fluorene-9,4'-oxane].
Molecular Properties
| Compound Name | 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] |
| PubChem CID | 23151773 |
| Molecular Formula | C18H17FO |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] |
| SMILES | Cc1ccc2c(c1)C1(CCOCC1)c1cccc(F)c1-2 |
| InChI | InChI=1S/C18H17FO/c1-12-5-6-13-15(11-12)18(7-9-20-10-8-18)14-3-2-4-16(19)17(13)14/h2-6,11H,7-10H2,1H3 |
| InChIKey | JLGXBMGFHGCSDK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylspiro[fluorene-9,4'-oxane]?
The IUPAC name of 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] (CID 23151773) is 5-fluoro-2-methylspiro[fluorene-9,4'-oxane].
What is the SMILES notation for 5-fluoro-2-methylspiro[fluorene-9,4'-oxane]?
The canonical SMILES for 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] is Cc1ccc2c(c1)C1(CCOCC1)c1cccc(F)c1-2.
What is the InChIKey of 5-fluoro-2-methylspiro[fluorene-9,4'-oxane]?
The InChIKey is JLGXBMGFHGCSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FO/c1-12-5-6-13-15(11-12)18(7-9-20-10-8-18)14-3-2-4-16(19)17(13)14/h2-6,11H,7-10H2,1H3.
What are the key properties of 5-fluoro-2-methylspiro[fluorene-9,4'-oxane]?
5-fluoro-2-methylspiro[fluorene-9,4'-oxane] has a molecular weight of 268.33 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylspiro[fluorene-9,4'-oxane] is sourced from PubChem (CID 23151773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).