About (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone
(3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone (PubChem CID 23152249) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone |
| PubChem CID | 23152249 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone |
| SMILES | Nc1cc(N)cc(C(=O)c2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C13H12N2O3/c14-8-3-7(4-9(15)5-8)13(18)11-2-1-10(16)6-12(11)17/h1-6,16-17H,14-15H2 |
| InChIKey | VLVANZOEYYZPRC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone?
The IUPAC name of (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone (CID 23152249) is (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone.
What is the SMILES notation for (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone?
The canonical SMILES for (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone is Nc1cc(N)cc(C(=O)c2ccc(O)cc2O)c1.
What is the InChIKey of (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone?
The InChIKey is VLVANZOEYYZPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c14-8-3-7(4-9(15)5-8)13(18)11-2-1-10(16)6-12(11)17/h1-6,16-17H,14-15H2.
What are the key properties of (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone?
(3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone has a molecular weight of 244.25 g/mol, XLogP of 1.49, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diaminophenyl)-(2,4-dihydroxyphenyl)methanone is sourced from PubChem (CID 23152249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).