C24H25N3O3 — CID 23152739
ethyl 18-cyclohexyl-9-oxo-8,11,13-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene-14-carboxylate (PubChem CID 23152739) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is ethyl 18-cyclohexyl-9-oxo-8,11,13-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene-14-carboxylate.
| Compound Name | ethyl 18-cyclohexyl-9-oxo-8,11,13-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene-14-carboxylate |
|---|---|
| PubChem CID | 23152739 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | ethyl 18-cyclohexyl-9-oxo-8,11,13-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene-14-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(C3CCCCC3)c3n(c2n1)CC(=O)Nc1ccccc1-3 |
| InChI | InChI=1S/C24H25N3O3/c1-2-30-24(29)19-13-12-17-21(15-8-4-3-5-9-15)22-16-10-6-7-11-18(16)25-20(28)14-27(22)23(17)26-19/h6-7,10-13,15H,2-5,8-9,14H2,1H3,(H,25,28) |
| InChIKey | FRFFWYBVJBLSGI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |