C21H17FN2O4 — CID 23153492
methyl 4-[3-fluoro-4-(phenylmethoxycarbonylamino)phenyl]pyridine-2-carboxylate (PubChem CID 23153492) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl 4-[3-fluoro-4-(phenylmethoxycarbonylamino)phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-[3-fluoro-4-(phenylmethoxycarbonylamino)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 23153492 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | methyl 4-[3-fluoro-4-(phenylmethoxycarbonylamino)phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(NC(=O)OCc3ccccc3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H17FN2O4/c1-27-20(25)19-12-16(9-10-23-19)15-7-8-18(17(22)11-15)24-21(26)28-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | CSAFOLNBTDKVNQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |