About 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one
3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one (PubChem CID 23153969) has the molecular formula C24H18F2N4O2
and a molecular weight of 432.43 g/mol. Its IUPAC name is 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one |
| PubChem CID | 23153969 |
| Molecular Formula | C24H18F2N4O2 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one |
| SMILES | COc1ccc(Cn2c(=O)c3c(N)n(-c4cc(F)ccc4F)nc3c3ccccc32)cc1 |
| InChI | InChI=1S/C24H18F2N4O2/c1-32-16-9-6-14(7-10-16)13-29-19-5-3-2-4-17(19)22-21(24(29)31)23(27)30(28-22)20-12-15(25)8-11-18(20)26/h2-12H,13,27H2,1H3 |
| InChIKey | XARGPULMBCCWJD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one?
The IUPAC name of 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one (CID 23153969) is 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one.
What is the SMILES notation for 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one?
The canonical SMILES for 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one is COc1ccc(Cn2c(=O)c3c(N)n(-c4cc(F)ccc4F)nc3c3ccccc32)cc1.
What is the InChIKey of 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one?
The InChIKey is XARGPULMBCCWJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F2N4O2/c1-32-16-9-6-14(7-10-16)13-29-19-5-3-2-4-17(19)22-21(24(29)31)23(27)30(28-22)20-12-15(25)8-11-18(20)26/h2-12H,13,27H2,1H3.
What are the key properties of 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one?
3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one has a molecular weight of 432.43 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,5-difluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]quinolin-4-one is sourced from PubChem (CID 23153969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).