About 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide
4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (PubChem CID 2315407) has the molecular formula C22H19N3O2
and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
Molecular Properties
| Compound Name | 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| PubChem CID | 2315407 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| SMILES | CCOc1ccc(C(=O)/N=C2\N=C3C=CC=CN3Cc3ccccc32)cc1 |
| InChI | InChI=1S/C22H19N3O2/c1-2-27-18-12-10-16(11-13-18)22(26)24-21-19-8-4-3-7-17(19)15-25-14-6-5-9-20(25)23-21/h3-14H,2,15H2,1H3/b24-21- |
| InChIKey | DNZSBCLWYMKGFQ-FLFQWRMESA-N |
| XLogP | 3.97 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The IUPAC name of 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (CID 2315407) is 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
What is the SMILES notation for 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The canonical SMILES for 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is CCOc1ccc(C(=O)/N=C2\N=C3C=CC=CN3Cc3ccccc32)cc1.
What is the InChIKey of 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The InChIKey is DNZSBCLWYMKGFQ-FLFQWRMESA-N. The full InChI is InChI=1S/C22H19N3O2/c1-2-27-18-12-10-16(11-13-18)22(26)24-21-19-8-4-3-7-17(19)15-25-14-6-5-9-20(25)23-21/h3-14H,2,15H2,1H3/b24-21-.
What are the key properties of 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide has a molecular weight of 357.41 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is sourced from PubChem (CID 2315407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).