C28H32N2O2 — CID 23154308
N,N'-bis[1-(6-methoxynaphthalen-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 23154308) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N,N'-bis[1-(6-methoxynaphthalen-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[1-(6-methoxynaphthalen-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 23154308 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N,N'-bis[1-(6-methoxynaphthalen-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | COc1ccc2cc(C(C)NCCNC(C)c3ccc4cc(OC)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C28H32N2O2/c1-19(21-5-7-25-17-27(31-3)11-9-23(25)15-21)29-13-14-30-20(2)22-6-8-26-18-28(32-4)12-10-24(26)16-22/h5-12,15-20,29-30H,13-14H2,1-4H3 |
| InChIKey | ZIZAHCHKXDUVNK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|