C15H26N6 — CID 23154848
N-[3-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]propyl]-1,3-dimethyl-4H-pyrimidin-2-imine (PubChem CID 23154848) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is N-[3-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]propyl]-1,3-dimethyl-4H-pyrimidin-2-imine.
| Compound Name | N-[3-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]propyl]-1,3-dimethyl-4H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 23154848 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-[3-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]propyl]-1,3-dimethyl-4H-pyrimidin-2-imine |
| SMILES | CN1C=CCN(C)/C1=N/CCC/N=C1/N(C)C=CCN1C |
| InChI | InChI=1S/C15H26N6/c1-18-10-6-11-19(2)14(18)16-8-5-9-17-15-20(3)12-7-13-21(15)4/h6-7,10,12H,5,8-9,11,13H2,1-4H3/b16-14-,17-15+ |
| InChIKey | STDUUHHDWPXAER-QUDUTFMFSA-N |
| XLogP | 0.87 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|