C14H24N6 — CID 23154879
N-[2-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]ethyl]-1,3-dimethyl-4H-pyrimidin-2-imine (PubChem CID 23154879) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is N-[2-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]ethyl]-1,3-dimethyl-4H-pyrimidin-2-imine.
| Compound Name | N-[2-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]ethyl]-1,3-dimethyl-4H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 23154879 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | N-[2-[(1,3-dimethyl-4H-pyrimidin-2-ylidene)amino]ethyl]-1,3-dimethyl-4H-pyrimidin-2-imine |
| SMILES | CN1C=CCN(C)/C1=N/CC/N=C1\N(C)C=CCN1C |
| InChI | InChI=1S/C14H24N6/c1-17-9-5-10-18(2)13(17)15-7-8-16-14-19(3)11-6-12-20(14)4/h5-6,9,11H,7-8,10,12H2,1-4H3/b15-13+,16-14+ |
| InChIKey | ZTHIYPVFBOABPK-WXUKJITCSA-N |
| XLogP | 0.48 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|