6-formylimidazo[1,2-a]pyridine-2-carboxylic acid

C9H6N2O3 — CID 23155605

IUPAC6-formylimidazo[1,2-a]pyridine-2-carboxylic acid
SMILESO=Cc1ccc2nc(C(=O)O)cn2c1
InChIInChI=1S/C9H6N2O3/c12-5-6-1-2-8-10-7(9(13)14)4-11(8)3-6/h1-5H,(H,13,14)
InChIKeyAPRJDUOWJBWPMP-UHFFFAOYSA-N
MW190.16 g/mol
LogP0.85
Rot. Bonds2

About 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid

6-formylimidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 23155605) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-formylimidazo[1,2-a]pyridine-2-carboxylic acid
PubChem CID23155605
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name6-formylimidazo[1,2-a]pyridine-2-carboxylic acid
SMILESO=Cc1ccc2nc(C(=O)O)cn2c1
InChIInChI=1S/C9H6N2O3/c12-5-6-1-2-8-10-7(9(13)14)4-11(8)3-6/h1-5H,(H,13,14)
InChIKeyAPRJDUOWJBWPMP-UHFFFAOYSA-N
XLogP0.85
TPSA71.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid?
The IUPAC name of 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid (CID 23155605) is 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid?
The canonical SMILES for 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid is O=Cc1ccc2nc(C(=O)O)cn2c1.
What is the InChIKey of 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid?
The InChIKey is APRJDUOWJBWPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-5-6-1-2-8-10-7(9(13)14)4-11(8)3-6/h1-5H,(H,13,14).
What are the key properties of 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid?
6-formylimidazo[1,2-a]pyridine-2-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formylimidazo[1,2-a]pyridine-2-carboxylic acid is sourced from PubChem (CID 23155605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).