C27H36N6O — CID 23155840
3-amino-2-[4-[4-(3,4-dimethylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 23155840) has the molecular formula C27H36N6O and a molecular weight of 460.63 g/mol. Its IUPAC name is 3-amino-2-[4-[4-(3,4-dimethylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-amino-2-[4-[4-(3,4-dimethylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 23155840 |
| Molecular Formula | C27H36N6O |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 3-amino-2-[4-[4-(3,4-dimethylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | Cc1c(N2CCN(CCCCc3nc4c(c(=O)n3N)CCCC4)CC2)nc2ccccc2c1C |
| InChI | InChI=1S/C27H36N6O/c1-19-20(2)26(30-23-11-5-3-9-21(19)23)32-17-15-31(16-18-32)14-8-7-13-25-29-24-12-6-4-10-22(24)27(34)33(25)28/h3,5,9,11H,4,6-8,10,12-18,28H2,1-2H3 |
| InChIKey | ZRMKLDGEAIPBEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|