C29H31N7OS2 — CID 23155950
3-amino-5,6-dimethyl-2-[3-[4-(3-phenylquinoxalin-2-yl)piperazin-1-yl]propylsulfanyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 23155950) has the molecular formula C29H31N7OS2 and a molecular weight of 557.75 g/mol. Its IUPAC name is 3-amino-5,6-dimethyl-2-[3-[4-(3-phenylquinoxalin-2-yl)piperazin-1-yl]propylsulfanyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-amino-5,6-dimethyl-2-[3-[4-(3-phenylquinoxalin-2-yl)piperazin-1-yl]propylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23155950 |
| Molecular Formula | C29H31N7OS2 |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-amino-5,6-dimethyl-2-[3-[4-(3-phenylquinoxalin-2-yl)piperazin-1-yl]propylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(SCCCN3CCN(c4nc5ccccc5nc4-c4ccccc4)CC3)n(N)c(=O)c2c1C |
| InChI | InChI=1S/C29H31N7OS2/c1-19-20(2)39-27-24(19)28(37)36(30)29(33-27)38-18-8-13-34-14-16-35(17-15-34)26-25(21-9-4-3-5-10-21)31-22-11-6-7-12-23(22)32-26/h3-7,9-12H,8,13-18,30H2,1-2H3 |
| InChIKey | MPEGWVZSANJAMN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|