C26H34N6O — CID 23155963
3-amino-2-[4-[4-(3-methylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 23155963) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 3-amino-2-[4-[4-(3-methylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-amino-2-[4-[4-(3-methylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 23155963 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 3-amino-2-[4-[4-(3-methylquinolin-2-yl)piperazin-1-yl]butyl]-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | Cc1cc2ccccc2nc1N1CCN(CCCCc2nc3c(c(=O)n2N)CCCC3)CC1 |
| InChI | InChI=1S/C26H34N6O/c1-19-18-20-8-2-4-10-22(20)29-25(19)31-16-14-30(15-17-31)13-7-6-12-24-28-23-11-5-3-9-21(23)26(33)32(24)27/h2,4,8,10,18H,3,5-7,9,11-17,27H2,1H3 |
| InChIKey | LZVLTVPNYIRFTB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|