C24H27N5OS2 — CID 23155980
5,6-dimethyl-2-[3-(4-quinolin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 23155980) has the molecular formula C24H27N5OS2 and a molecular weight of 465.65 g/mol. Its IUPAC name is 5,6-dimethyl-2-[3-(4-quinolin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[3-(4-quinolin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23155980 |
| Molecular Formula | C24H27N5OS2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 5,6-dimethyl-2-[3-(4-quinolin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(SCCCN3CCN(c4ccc5ccccc5n4)CC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C24H27N5OS2/c1-16-17(2)32-23-21(16)22(30)26-24(27-23)31-15-5-10-28-11-13-29(14-12-28)20-9-8-18-6-3-4-7-19(18)25-20/h3-4,6-9H,5,10-15H2,1-2H3,(H,26,27,30) |
| InChIKey | DWCWRMNZCYONIV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|