C14H9FN2O — CID 23156497
2-(4-fluorophenyl)-1,8-naphthyridin-3-ol (PubChem CID 23156497) has the molecular formula C14H9FN2O and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,8-naphthyridin-3-ol.
| Compound Name | 2-(4-fluorophenyl)-1,8-naphthyridin-3-ol |
|---|---|
| PubChem CID | 23156497 |
| Molecular Formula | C14H9FN2O |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(4-fluorophenyl)-1,8-naphthyridin-3-ol |
| SMILES | Oc1cc2cccnc2nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9FN2O/c15-11-5-3-9(4-6-11)13-12(18)8-10-2-1-7-16-14(10)17-13/h1-8,18H |
| InChIKey | FQDGYQZDMXXJPV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |