C22H21F3N2O2 — CID 23156872
7-[2-(hydroxymethyl)piperidin-1-yl]-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-1-one (PubChem CID 23156872) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 7-[2-(hydroxymethyl)piperidin-1-yl]-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-1-one.
| Compound Name | 7-[2-(hydroxymethyl)piperidin-1-yl]-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 23156872 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 7-[2-(hydroxymethyl)piperidin-1-yl]-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(-c2ccccc2C(F)(F)F)cc2ccc(N3CCCCC3CO)cc12 |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)19-7-2-1-6-17(19)20-11-14-8-9-15(12-18(14)21(29)26-20)27-10-4-3-5-16(27)13-28/h1-2,6-9,11-12,16,28H,3-5,10,13H2,(H,26,29) |
| InChIKey | QLMBXMJBFOJCDW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |