About 5-bromo-N,2-dimethylbenzamide
5-bromo-N,2-dimethylbenzamide (PubChem CID 23156913) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 5-bromo-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | 5-bromo-N,2-dimethylbenzamide |
| PubChem CID | 23156913 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 5-bromo-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C9H10BrNO/c1-6-3-4-7(10)5-8(6)9(12)11-2/h3-5H,1-2H3,(H,11,12) |
| InChIKey | HQMSFKCYMRDNAE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,2-dimethylbenzamide?
The IUPAC name of 5-bromo-N,2-dimethylbenzamide (CID 23156913) is 5-bromo-N,2-dimethylbenzamide.
What is the SMILES notation for 5-bromo-N,2-dimethylbenzamide?
The canonical SMILES for 5-bromo-N,2-dimethylbenzamide is CNC(=O)c1cc(Br)ccc1C.
What is the InChIKey of 5-bromo-N,2-dimethylbenzamide?
The InChIKey is HQMSFKCYMRDNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c1-6-3-4-7(10)5-8(6)9(12)11-2/h3-5H,1-2H3,(H,11,12).
What are the key properties of 5-bromo-N,2-dimethylbenzamide?
5-bromo-N,2-dimethylbenzamide has a molecular weight of 228.09 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,2-dimethylbenzamide is sourced from PubChem (CID 23156913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).