About 3,5-dimethylphthalaldehyde
3,5-dimethylphthalaldehyde (PubChem CID 23156924) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3,5-dimethylphthalaldehyde.
Molecular Properties
| Compound Name | 3,5-dimethylphthalaldehyde |
| PubChem CID | 23156924 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 3,5-dimethylphthalaldehyde |
| SMILES | Cc1cc(C)c(C=O)c(C=O)c1 |
| InChI | InChI=1S/C10H10O2/c1-7-3-8(2)10(6-12)9(4-7)5-11/h3-6H,1-2H3 |
| InChIKey | DCVXVYJUGHACBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethylphthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylphthalaldehyde?
The IUPAC name of 3,5-dimethylphthalaldehyde (CID 23156924) is 3,5-dimethylphthalaldehyde.
What is the SMILES notation for 3,5-dimethylphthalaldehyde?
The canonical SMILES for 3,5-dimethylphthalaldehyde is Cc1cc(C)c(C=O)c(C=O)c1.
What is the InChIKey of 3,5-dimethylphthalaldehyde?
The InChIKey is DCVXVYJUGHACBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-7-3-8(2)10(6-12)9(4-7)5-11/h3-6H,1-2H3.
What are the key properties of 3,5-dimethylphthalaldehyde?
3,5-dimethylphthalaldehyde has a molecular weight of 162.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylphthalaldehyde is sourced from PubChem (CID 23156924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).