C17H29NO2Si — CID 23157023
[9-[tert-butyl(dimethyl)silyl]oxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-7-yl]methanol (PubChem CID 23157023) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is [9-[tert-butyl(dimethyl)silyl]oxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-7-yl]methanol.
| Compound Name | [9-[tert-butyl(dimethyl)silyl]oxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 23157023 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [9-[tert-butyl(dimethyl)silyl]oxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-7-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(CO)CCc2cccnc21 |
| InChI | InChI=1S/C17H29NO2Si/c1-17(2,3)21(4,5)20-15-11-13(12-19)8-9-14-7-6-10-18-16(14)15/h6-7,10,13,15,19H,8-9,11-12H2,1-5H3 |
| InChIKey | POYJIIOIMVZAGL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|