C16H25NO3Si — CID 23157139
8-triethylsilyloxy-5,6,7,8-tetrahydroquinoline-6-carboxylic acid (PubChem CID 23157139) has the molecular formula C16H25NO3Si and a molecular weight of 307.47 g/mol. Its IUPAC name is 8-triethylsilyloxy-5,6,7,8-tetrahydroquinoline-6-carboxylic acid.
| Compound Name | 8-triethylsilyloxy-5,6,7,8-tetrahydroquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 23157139 |
| Molecular Formula | C16H25NO3Si |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 8-triethylsilyloxy-5,6,7,8-tetrahydroquinoline-6-carboxylic acid |
| SMILES | CC[Si](CC)(CC)OC1CC(C(=O)O)Cc2cccnc21 |
| InChI | InChI=1S/C16H25NO3Si/c1-4-21(5-2,6-3)20-14-11-13(16(18)19)10-12-8-7-9-17-15(12)14/h7-9,13-14H,4-6,10-11H2,1-3H3,(H,18,19) |
| InChIKey | FSQJHDRLAFNNSW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|