C30H36FNO4 — CID 23157227
ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluoropropanoate (PubChem CID 23157227) has the molecular formula C30H36FNO4 and a molecular weight of 493.62 g/mol. Its IUPAC name is ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluoropropanoate.
| Compound Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluoropropanoate |
|---|---|
| PubChem CID | 23157227 |
| Molecular Formula | C30H36FNO4 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluoropropanoate |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc(CC(F)C(=O)OCC)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C30H36FNO4/c1-5-34-14-15-36-27-16-21(3)29(22(4)17-27)25-9-7-8-24(18-25)20-32-26-12-10-23(11-13-26)19-28(31)30(33)35-6-2/h7-13,16-18,28,32H,5-6,14-15,19-20H2,1-4H3 |
| InChIKey | YZVDQCIGOMQKJL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|