C28H31F2NO4 — CID 23157272
3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoic acid (PubChem CID 23157272) has the molecular formula C28H31F2NO4 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoic acid.
| Compound Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 23157272 |
| Molecular Formula | C28H31F2NO4 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoic acid |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc(CC(F)(F)C(=O)O)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C28H31F2NO4/c1-4-34-12-13-35-25-14-19(2)26(20(3)15-25)23-7-5-6-22(16-23)18-31-24-10-8-21(9-11-24)17-28(29,30)27(32)33/h5-11,14-16,31H,4,12-13,17-18H2,1-3H3,(H,32,33) |
| InChIKey | YWZGNZZEYIBDTL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|