About 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene
1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene (PubChem CID 23157400) has the molecular formula C14H21BrO2
and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene |
| PubChem CID | 23157400 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene |
| SMILES | CCOCCOc1c(C)c(C)c(Br)c(C)c1C |
| InChI | InChI=1S/C14H21BrO2/c1-6-16-7-8-17-14-11(4)9(2)13(15)10(3)12(14)5/h6-8H2,1-5H3 |
| InChIKey | SVTSNKDDEXJEAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene?
The IUPAC name of 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene (CID 23157400) is 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene.
What is the SMILES notation for 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene?
The canonical SMILES for 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene is CCOCCOc1c(C)c(C)c(Br)c(C)c1C.
What is the InChIKey of 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene?
The InChIKey is SVTSNKDDEXJEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrO2/c1-6-16-7-8-17-14-11(4)9(2)13(15)10(3)12(14)5/h6-8H2,1-5H3.
What are the key properties of 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene?
1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene has a molecular weight of 301.22 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(2-ethoxyethoxy)-2,3,5,6-tetramethylbenzene is sourced from PubChem (CID 23157400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).