C41H33N4O7S2- — CID 23157471
2-[6-[(2-nitrophenyl)sulfonyl-[[4-[[2-phenylethyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]phenyl]methyl]amino]-1-benzofuran-3-yl]acetate (PubChem CID 23157471) has the molecular formula C41H33N4O7S2- and a molecular weight of 757.87 g/mol. Its IUPAC name is 2-[6-[(2-nitrophenyl)sulfonyl-[[4-[[2-phenylethyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]phenyl]methyl]amino]-1-benzofuran-3-yl]acetate.
| Compound Name | 2-[6-[(2-nitrophenyl)sulfonyl-[[4-[[2-phenylethyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]phenyl]methyl]amino]-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 23157471 |
| Molecular Formula | C41H33N4O7S2- |
| Molecular Weight | 757.87 g/mol |
| Exact Mass | 757.18 |
| IUPAC Name | 2-[6-[(2-nitrophenyl)sulfonyl-[[4-[[2-phenylethyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]phenyl]methyl]amino]-1-benzofuran-3-yl]acetate |
| SMILES | O=C([O-])Cc1coc2cc(N(Cc3ccc(CN(CCc4ccccc4)c4nc(-c5ccccc5)cs4)cc3)S(=O)(=O)c3ccccc3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C41H34N4O7S2/c46-40(47)23-33-27-52-38-24-34(19-20-35(33)38)44(54(50,51)39-14-8-7-13-37(39)45(48)49)26-31-17-15-30(16-18-31)25-43(22-21-29-9-3-1-4-10-29)41-42-36(28-53-41)32-11-5-2-6-12-32/h1-20,24,27-28H,21-23,25-26H2,(H,46,47)/p-1 |
| InChIKey | DKLKKIMAVCMIQG-UHFFFAOYSA-M |
| XLogP | 7.40 |
| TPSA | 149.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.87 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|