About 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione
3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione (PubChem CID 23158234) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione.
Molecular Properties
| Compound Name | 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione |
| PubChem CID | 23158234 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione |
| SMILES | Cc1coc2[nH]c(=O)ccc2c1=O |
| InChI | InChI=1S/C9H7NO3/c1-5-4-13-9-6(8(5)12)2-3-7(11)10-9/h2-4H,1H3,(H,10,11) |
| InChIKey | LGIZXSCPJTXASJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione?
The IUPAC name of 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione (CID 23158234) is 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione.
What is the SMILES notation for 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione?
The canonical SMILES for 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione is Cc1coc2[nH]c(=O)ccc2c1=O.
What is the InChIKey of 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione?
The InChIKey is LGIZXSCPJTXASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c1-5-4-13-9-6(8(5)12)2-3-7(11)10-9/h2-4H,1H3,(H,10,11).
What are the key properties of 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione?
3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione has a molecular weight of 177.16 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8H-pyrano[2,3-b]pyridine-4,7-dione is sourced from PubChem (CID 23158234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).