C18H15FN6O2 — CID 23158266
ethyl 6-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 23158266) has the molecular formula C18H15FN6O2 and a molecular weight of 366.36 g/mol. Its IUPAC name is ethyl 6-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 23158266 |
| Molecular Formula | C18H15FN6O2 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl 6-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2cc(-c3nnn(-c4cccnc4F)c3C)ccc2n1 |
| InChI | InChI=1S/C18H15FN6O2/c1-3-27-18(26)13-10-24-9-12(6-7-15(24)21-13)16-11(2)25(23-22-16)14-5-4-8-20-17(14)19/h4-10H,3H2,1-2H3 |
| InChIKey | KRSIRGXFJVTPOI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|