C13H16N4OS — CID 2315873
3-[4-(dimethylamino)phenyl]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 2315873) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 2315873 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | CN(C)c1ccc(N2CN=C3SCC(=O)N3C2)cc1 |
| InChI | InChI=1S/C13H16N4OS/c1-15(2)10-3-5-11(6-4-10)16-8-14-13-17(9-16)12(18)7-19-13/h3-6H,7-9H2,1-2H3 |
| InChIKey | GKOSTBSFAISSOK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|