About [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate
[5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate (PubChem CID 23158784) has the molecular formula C13H16N6O8S
and a molecular weight of 416.37 g/mol. Its IUPAC name is [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate.
Molecular Properties
| Compound Name | [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate |
| PubChem CID | 23158784 |
| Molecular Formula | C13H16N6O8S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate |
| SMILES | COC(=O)Oc1cnn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H16N6O8S/c1-19-10(7(6-14-19)27-13(21)26-4)28(22,23)18-12(20)17-11-15-8(24-2)5-9(16-11)25-3/h5-6H,1-4H3,(H2,15,16,17,18,20) |
| InChIKey | GLQSKHYGFVDVKA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The IUPAC name of [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate (CID 23158784) is [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate.
What is the SMILES notation for [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The canonical SMILES for [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate is COC(=O)Oc1cnn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1.
What is the InChIKey of [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The InChIKey is GLQSKHYGFVDVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N6O8S/c1-19-10(7(6-14-19)27-13(21)26-4)28(22,23)18-12(20)17-11-15-8(24-2)5-9(16-11)25-3/h5-6H,1-4H3,(H2,15,16,17,18,20).
What are the key properties of [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
[5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate has a molecular weight of 416.37 g/mol, XLogP of -0.12, 6 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate is sourced from PubChem (CID 23158784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).