About N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide
N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 2315879) has the molecular formula C13H12N2O4S
and a molecular weight of 292.32 g/mol. Its IUPAC name is N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
Molecular Properties
| Compound Name | N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| PubChem CID | 2315879 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccn1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H12N2O4S/c16-20(17,15-13-3-1-2-6-14-13)10-4-5-11-12(9-10)19-8-7-18-11/h1-6,9H,7-8H2,(H,14,15) |
| InChIKey | LRACHUIAJOLOFR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The IUPAC name of N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CID 2315879) is N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
What is the SMILES notation for N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The canonical SMILES for N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is O=S(=O)(Nc1ccccn1)c1ccc2c(c1)OCCO2.
What is the InChIKey of N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The InChIKey is LRACHUIAJOLOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4S/c16-20(17,15-13-3-1-2-6-14-13)10-4-5-11-12(9-10)19-8-7-18-11/h1-6,9H,7-8H2,(H,14,15).
What are the key properties of N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide has a molecular weight of 292.32 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-2-yl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is sourced from PubChem (CID 2315879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).