C37H46N2O5 — CID 23158795
(5E)-8-[4-(2-butoxyethoxy)phenyl]-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-3,4-dihydro-2H-1-benzoxocine-5-carboxamide (PubChem CID 23158795) has the molecular formula C37H46N2O5 and a molecular weight of 598.78 g/mol. Its IUPAC name is (5E)-8-[4-(2-butoxyethoxy)phenyl]-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-3,4-dihydro-2H-1-benzoxocine-5-carboxamide.
| Compound Name | (5E)-8-[4-(2-butoxyethoxy)phenyl]-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-3,4-dihydro-2H-1-benzoxocine-5-carboxamide |
|---|---|
| PubChem CID | 23158795 |
| Molecular Formula | C37H46N2O5 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | (5E)-8-[4-(2-butoxyethoxy)phenyl]-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-3,4-dihydro-2H-1-benzoxocine-5-carboxamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)/C=C(/C(=O)Nc2ccc(CN(C)C4CCOCC4)cc2)CCCO3)cc1 |
| InChI | InChI=1S/C37H46N2O5/c1-3-4-19-41-23-24-43-35-14-9-29(10-15-35)30-11-16-36-32(25-30)26-31(6-5-20-44-36)37(40)38-33-12-7-28(8-13-33)27-39(2)34-17-21-42-22-18-34/h7-16,25-26,34H,3-6,17-24,27H2,1-2H3,(H,38,40)/b31-26+ |
| InChIKey | NAZMGKDHVKABHN-GKPLWNPISA-N |
| XLogP | 7.35 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|