C26H26N2O2S — CID 23158825
5-(1,3-benzothiazol-2-yl)-10,10,15,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 23158825) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-10,10,15,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-10,10,15,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 23158825 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-10,10,15,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1CN2CCC(C)(C)c3cc4cc(-c5nc6ccccc6s5)c(=O)oc4c(c32)C1C |
| InChI | InChI=1S/C26H26N2O2S/c1-14-13-28-10-9-26(3,4)18-12-16-11-17(24-27-19-7-5-6-8-20(19)31-24)25(29)30-23(16)21(15(14)2)22(18)28/h5-8,11-12,14-15H,9-10,13H2,1-4H3 |
| InChIKey | HCVWHDNEZZVEOO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|