About [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate
[2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate (PubChem CID 23158870) has the molecular formula C25H30O8
and a molecular weight of 458.51 g/mol. Its IUPAC name is [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate |
| PubChem CID | 23158870 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate |
| SMILES | O=COc1ccc(OC(=O)C2CCCC2)c(OC(=O)C2CCCC2)c1OC(=O)C1CCCC1 |
| InChI | InChI=1S/C25H30O8/c26-15-30-19-13-14-20(31-23(27)16-7-1-2-8-16)22(33-25(29)18-11-5-6-12-18)21(19)32-24(28)17-9-3-4-10-17/h13-18H,1-12H2 |
| InChIKey | ZUGKCIBGERWGKW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate?
The IUPAC name of [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate (CID 23158870) is [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate.
What is the SMILES notation for [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate?
The canonical SMILES for [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate is O=COc1ccc(OC(=O)C2CCCC2)c(OC(=O)C2CCCC2)c1OC(=O)C1CCCC1.
What is the InChIKey of [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate?
The InChIKey is ZUGKCIBGERWGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30O8/c26-15-30-19-13-14-20(31-23(27)16-7-1-2-8-16)22(33-25(29)18-11-5-6-12-18)21(19)32-24(28)17-9-3-4-10-17/h13-18H,1-12H2.
What are the key properties of [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate?
[2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate has a molecular weight of 458.51 g/mol, XLogP of 4.51, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(cyclopentanecarbonyloxy)-4-formyloxyphenyl] cyclopentanecarboxylate is sourced from PubChem (CID 23158870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).