About 4-chloroquinazolin-6-ol
4-chloroquinazolin-6-ol (PubChem CID 23160273) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 4-chloroquinazolin-6-ol.
Molecular Properties
| Compound Name | 4-chloroquinazolin-6-ol |
| PubChem CID | 23160273 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 4-chloroquinazolin-6-ol |
| SMILES | Oc1ccc2ncnc(Cl)c2c1 |
| InChI | InChI=1S/C8H5ClN2O/c9-8-6-3-5(12)1-2-7(6)10-4-11-8/h1-4,12H |
| InChIKey | DOFQCJUTUJSCOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloroquinazolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroquinazolin-6-ol?
The IUPAC name of 4-chloroquinazolin-6-ol (CID 23160273) is 4-chloroquinazolin-6-ol.
What is the SMILES notation for 4-chloroquinazolin-6-ol?
The canonical SMILES for 4-chloroquinazolin-6-ol is Oc1ccc2ncnc(Cl)c2c1.
What is the InChIKey of 4-chloroquinazolin-6-ol?
The InChIKey is DOFQCJUTUJSCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-8-6-3-5(12)1-2-7(6)10-4-11-8/h1-4,12H.
What are the key properties of 4-chloroquinazolin-6-ol?
4-chloroquinazolin-6-ol has a molecular weight of 180.59 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroquinazolin-6-ol is sourced from PubChem (CID 23160273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).