C24H50O6 — CID 23160396
1,2,3,4,5,6-hexapropoxyhexane (PubChem CID 23160396) has the molecular formula C24H50O6 and a molecular weight of 434.66 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexapropoxyhexane.
| Compound Name | 1,2,3,4,5,6-hexapropoxyhexane |
|---|---|
| PubChem CID | 23160396 |
| Molecular Formula | C24H50O6 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | 1,2,3,4,5,6-hexapropoxyhexane |
| SMILES | CCCOCC(OCCC)C(OCCC)C(OCCC)C(COCCC)OCCC |
| InChI | InChI=1S/C24H50O6/c1-7-13-25-19-21(27-15-9-3)23(29-17-11-5)24(30-18-12-6)22(28-16-10-4)20-26-14-8-2/h21-24H,7-20H2,1-6H3 |
| InChIKey | OLHYYLHJPJLYNJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|