About (2-propan-2-ylphenyl) sulfamate
(2-propan-2-ylphenyl) sulfamate (PubChem CID 23161118) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) sulfamate.
Molecular Properties
| Compound Name | (2-propan-2-ylphenyl) sulfamate |
| PubChem CID | 23161118 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (2-propan-2-ylphenyl) sulfamate |
| SMILES | CC(C)c1ccccc1OS(N)(=O)=O |
| InChI | InChI=1S/C9H13NO3S/c1-7(2)8-5-3-4-6-9(8)13-14(10,11)12/h3-7H,1-2H3,(H2,10,11,12) |
| InChIKey | OGAUXGQLRXYROS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-propan-2-ylphenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-ylphenyl) sulfamate?
The IUPAC name of (2-propan-2-ylphenyl) sulfamate (CID 23161118) is (2-propan-2-ylphenyl) sulfamate.
What is the SMILES notation for (2-propan-2-ylphenyl) sulfamate?
The canonical SMILES for (2-propan-2-ylphenyl) sulfamate is CC(C)c1ccccc1OS(N)(=O)=O.
What is the InChIKey of (2-propan-2-ylphenyl) sulfamate?
The InChIKey is OGAUXGQLRXYROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-7(2)8-5-3-4-6-9(8)13-14(10,11)12/h3-7H,1-2H3,(H2,10,11,12).
What are the key properties of (2-propan-2-ylphenyl) sulfamate?
(2-propan-2-ylphenyl) sulfamate has a molecular weight of 215.27 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-ylphenyl) sulfamate is sourced from PubChem (CID 23161118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).