About N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate
N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate (PubChem CID 23161144) has the molecular formula C20H20N3O6S-
and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate.
Molecular Properties
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate |
| PubChem CID | 23161144 |
| Molecular Formula | C20H20N3O6S- |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate |
| SMILES | COc1cccc(C2(C(=O)NS(=O)(=O)[O-])CCN(c3nc4ccccc4o3)CC2)c1 |
| InChI | InChI=1S/C20H21N3O6S/c1-28-15-6-4-5-14(13-15)20(18(24)22-30(25,26)27)9-11-23(12-10-20)19-21-16-7-2-3-8-17(16)29-19/h2-8,13H,9-12H2,1H3,(H,22,24)(H,25,26,27)/p-1 |
| InChIKey | FMHOESZZDSXGEE-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate?
The IUPAC name of N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate (CID 23161144) is N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate.
What is the SMILES notation for N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate?
The canonical SMILES for N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate is COc1cccc(C2(C(=O)NS(=O)(=O)[O-])CCN(c3nc4ccccc4o3)CC2)c1.
What is the InChIKey of N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate?
The InChIKey is FMHOESZZDSXGEE-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H21N3O6S/c1-28-15-6-4-5-14(13-15)20(18(24)22-30(25,26)27)9-11-23(12-10-20)19-21-16-7-2-3-8-17(16)29-19/h2-8,13H,9-12H2,1H3,(H,22,24)(H,25,26,27)/p-1.
What are the key properties of N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate?
N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate has a molecular weight of 430.46 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-benzoxazol-2-yl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate is sourced from PubChem (CID 23161144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).