C11H12Br2O — CID 2316192
(1S,2R,3R,5R,6S,7S,8R,9R,10S,11R)-7,11-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol (PubChem CID 2316192) has the molecular formula C11H12Br2O and a molecular weight of 320.02 g/mol. Its IUPAC name is (1S,2R,3R,5R,6S,7S,8R,9R,10S,11R)-7,11-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol.
| Compound Name | (1S,2R,3R,5R,6S,7S,8R,9R,10S,11R)-7,11-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol |
|---|---|
| PubChem CID | 2316192 |
| Molecular Formula | C11H12Br2O |
| Molecular Weight | 320.02 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | (1S,2R,3R,5R,6S,7S,8R,9R,10S,11R)-7,11-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol |
| SMILES | O[C@@]12[C@@H]3[C@@H](Br)[C@H]4[C@@H]5C[C@@H]([C@@H]([C@@H]53)[C@H]1Br)[C@H]42 |
| InChI | InChI=1S/C11H12Br2O/c12-9-6-2-1-3-5-4(2)8(9)11(14,7(3)6)10(5)13/h2-10,14H,1H2/t2-,3+,4-,5+,6+,7-,8+,9+,10-,11+/m1/s1 |
| InChIKey | NTSSKTSJOQWIIC-QBPWMKHJSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.02 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|