C21H29NO8 — CID 23161986
benzene-1,2,4,5-tetracarboxylic acid;1,2,2,4,6,6-hexamethylpiperidine (PubChem CID 23161986) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is benzene-1,2,4,5-tetracarboxylic acid;1,2,2,4,6,6-hexamethylpiperidine.
| Compound Name | benzene-1,2,4,5-tetracarboxylic acid;1,2,2,4,6,6-hexamethylpiperidine |
|---|---|
| PubChem CID | 23161986 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | benzene-1,2,4,5-tetracarboxylic acid;1,2,2,4,6,6-hexamethylpiperidine |
| SMILES | CC1CC(C)(C)N(C)C(C)(C)C1.O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C11H23N.C10H6O8/c1-9-7-10(2,3)12(6)11(4,5)8-9;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h9H,7-8H2,1-6H3;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | VIYRXEGWGMAHOK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |