C17H17N5O5S3 — CID 23162038
1-(4,6-dimethoxypyrimidin-2-yl)-3-[5-(2-methyl-1,3-thiazol-4-yl)-6-sulfanylidenecyclohexa-1,3-dien-1-yl]sulfonylurea (PubChem CID 23162038) has the molecular formula C17H17N5O5S3 and a molecular weight of 467.55 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-[5-(2-methyl-1,3-thiazol-4-yl)-6-sulfanylidenecyclohexa-1,3-dien-1-yl]sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[5-(2-methyl-1,3-thiazol-4-yl)-6-sulfanylidenecyclohexa-1,3-dien-1-yl]sulfonylurea |
|---|---|
| PubChem CID | 23162038 |
| Molecular Formula | C17H17N5O5S3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[5-(2-methyl-1,3-thiazol-4-yl)-6-sulfanylidenecyclohexa-1,3-dien-1-yl]sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)C2=CC=CC(c3csc(C)n3)C2=S)n1 |
| InChI | InChI=1S/C17H17N5O5S3/c1-9-18-11(8-29-9)10-5-4-6-12(15(10)28)30(24,25)22-17(23)21-16-19-13(26-2)7-14(20-16)27-3/h4-8,10H,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | BWLZXJAMUWAUJH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|