About 4-ethoxycyclohexa-2,4-dien-1-one
4-ethoxycyclohexa-2,4-dien-1-one (PubChem CID 23162256) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-ethoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 23162256 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-ethoxycyclohexa-2,4-dien-1-one |
| SMILES | CCOC1=CCC(=O)C=C1 |
| InChI | InChI=1S/C8H10O2/c1-2-10-8-5-3-7(9)4-6-8/h3,5-6H,2,4H2,1H3 |
| InChIKey | FISMLRKVZBTGAQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 4-ethoxycyclohexa-2,4-dien-1-one (CID 23162256) is 4-ethoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-ethoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-ethoxycyclohexa-2,4-dien-1-one is CCOC1=CCC(=O)C=C1.
What is the InChIKey of 4-ethoxycyclohexa-2,4-dien-1-one?
The InChIKey is FISMLRKVZBTGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-2-10-8-5-3-7(9)4-6-8/h3,5-6H,2,4H2,1H3.
What are the key properties of 4-ethoxycyclohexa-2,4-dien-1-one?
4-ethoxycyclohexa-2,4-dien-1-one has a molecular weight of 138.17 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 23162256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).