C20H10N4O — CID 23163299
5-oxapentacyclo[7.7.1.02,8.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-4,4,6,6-tetracarbonitrile (PubChem CID 23163299) has the molecular formula C20H10N4O and a molecular weight of 322.33 g/mol. Its IUPAC name is 5-oxapentacyclo[7.7.1.02,8.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-4,4,6,6-tetracarbonitrile.
| Compound Name | 5-oxapentacyclo[7.7.1.02,8.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-4,4,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 23163299 |
| Molecular Formula | C20H10N4O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 5-oxapentacyclo[7.7.1.02,8.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-4,4,6,6-tetracarbonitrile |
| SMILES | N#CC1(C#N)OC(C#N)(C#N)C2C3c4cccc5cccc(c45)C3C21 |
| InChI | InChI=1S/C20H10N4O/c21-7-19(8-22)17-15-12-5-1-3-11-4-2-6-13(14(11)12)16(15)18(17)20(9-23,10-24)25-19/h1-6,15-18H |
| InChIKey | BEMCVELNAIERPA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |