C29H29Cl2N2OP — CID 2316371
(4aR,9bS)-5-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 2316371) has the molecular formula C29H29Cl2N2OP and a molecular weight of 523.44 g/mol. Its IUPAC name is (4aR,9bS)-5-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bS)-5-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 2316371 |
| Molecular Formula | C29H29Cl2N2OP |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (4aR,9bS)-5-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@H]1N2P(=O)(/C=C(\Cl)c1ccccc1)/C=C(\Cl)c1ccccc1 |
| InChI | InChI=1S/C29H29Cl2N2OP/c1-21-13-14-28-24(17-21)25-18-32(2)16-15-29(25)33(28)35(34,19-26(30)22-9-5-3-6-10-22)20-27(31)23-11-7-4-8-12-23/h3-14,17,19-20,25,29H,15-16,18H2,1-2H3/b26-19-,27-20-/t25-,29-/m1/s1 |
| InChIKey | WCDXHNZUCUHPFT-NGOMHRBFSA-N |
| XLogP | 8.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|