About 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid
1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 23164231) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
| PubChem CID | 23164231 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O |
| InChI | InChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18) |
| InChIKey | WABVBCWVHCTXKG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (CID 23164231) is 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid is C=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O.
What is the InChIKey of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The InChIKey is WABVBCWVHCTXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18).
What are the key properties of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid has a molecular weight of 252.31 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 23164231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).