1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid

C14H20O4 — CID 23164231

IUPAC1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid
SMILESC=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O
InChIInChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18)
InChIKeyWABVBCWVHCTXKG-UHFFFAOYSA-N
MW252.31 g/mol
LogP2.85
Rot. Bonds6

About 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid

1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 23164231) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.

Molecular Properties

Compound Name1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid
PubChem CID23164231
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Name1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid
SMILESC=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O
InChIInChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18)
InChIKeyWABVBCWVHCTXKG-UHFFFAOYSA-N
XLogP2.85
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (CID 23164231) is 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid is C=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O.
What is the InChIKey of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
The InChIKey is WABVBCWVHCTXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18).
What are the key properties of 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid?
1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid has a molecular weight of 252.31 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 23164231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).