About [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate
[4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate (PubChem CID 2316475) has the molecular formula C20H18Cl2N2O2S
and a molecular weight of 421.35 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate |
| PubChem CID | 2316475 |
| Molecular Formula | C20H18Cl2N2O2S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)CCCCl)c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O2S/c1-14-19(27-17-11-9-15(22)10-12-17)20(26-18(25)8-5-13-21)24(23-14)16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13H2,1H3 |
| InChIKey | NBJIFYFWZQEYAO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate?
The IUPAC name of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate (CID 2316475) is [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate.
What is the SMILES notation for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate?
The canonical SMILES for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate is Cc1nn(-c2ccccc2)c(OC(=O)CCCCl)c1Sc1ccc(Cl)cc1.
What is the InChIKey of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate?
The InChIKey is NBJIFYFWZQEYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O2S/c1-14-19(27-17-11-9-15(22)10-12-17)20(26-18(25)8-5-13-21)24(23-14)16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13H2,1H3.
What are the key properties of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate?
[4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate has a molecular weight of 421.35 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 4-chlorobutanoate is sourced from PubChem (CID 2316475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).