C20H34ClNO7P2 — CID 23164906
N-(4-chlorophenyl)-2,2-bis[di(propan-2-yloxy)phosphoryl]acetamide (PubChem CID 23164906) has the molecular formula C20H34ClNO7P2 and a molecular weight of 497.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,2-bis[di(propan-2-yloxy)phosphoryl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2,2-bis[di(propan-2-yloxy)phosphoryl]acetamide |
|---|---|
| PubChem CID | 23164906 |
| Molecular Formula | C20H34ClNO7P2 |
| Molecular Weight | 497.89 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-(4-chlorophenyl)-2,2-bis[di(propan-2-yloxy)phosphoryl]acetamide |
| SMILES | CC(C)OP(=O)(OC(C)C)C(C(=O)Nc1ccc(Cl)cc1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H34ClNO7P2/c1-13(2)26-30(24,27-14(3)4)20(31(25,28-15(5)6)29-16(7)8)19(23)22-18-11-9-17(21)10-12-18/h9-16,20H,1-8H3,(H,22,23) |
| InChIKey | KFTFWHZNEKVVKP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.89 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|