About 8H-chromene-4,7-dione
8H-chromene-4,7-dione (PubChem CID 23165051) has the molecular formula C9H6O3
and a molecular weight of 162.14 g/mol. Its IUPAC name is 8H-chromene-4,7-dione.
Molecular Properties
| Compound Name | 8H-chromene-4,7-dione |
| PubChem CID | 23165051 |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 8H-chromene-4,7-dione |
| SMILES | O=C1C=Cc2c(occc2=O)C1 |
| InChI | InChI=1S/C9H6O3/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-4H,5H2 |
| InChIKey | JWVUXJAHECOVIX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8H-chromene-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-chromene-4,7-dione?
The IUPAC name of 8H-chromene-4,7-dione (CID 23165051) is 8H-chromene-4,7-dione.
What is the SMILES notation for 8H-chromene-4,7-dione?
The canonical SMILES for 8H-chromene-4,7-dione is O=C1C=Cc2c(occc2=O)C1.
What is the InChIKey of 8H-chromene-4,7-dione?
The InChIKey is JWVUXJAHECOVIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-4H,5H2.
What are the key properties of 8H-chromene-4,7-dione?
8H-chromene-4,7-dione has a molecular weight of 162.14 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-chromene-4,7-dione is sourced from PubChem (CID 23165051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).